| Name | Docosanoic acid methyl ester |
| Synonyms | C22 Kemester 9022 METHYL BEHENATE Methyl docosanoate METHYL DOCOSANOATE BEHENIC ACID METHYL ESTER Behenic Acid Methyl Ester Docosanoic acid methyl ester Docosanoic acid, methyl ester n-Docosanoic acid methyl ester |
| CAS | 929-77-1 |
| EINECS | 213-207-8 |
| InChI | InChI=1/C23H46O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h3-22H2,1-2H3 |
| Molecular Formula | C23H46O2 |
| Molar Mass | 354.61 |
| Density | 0.8784 (rough estimate) |
| Melting Point | 54-56°C(lit.) |
| Boling Point | 393 °C |
| Flash Point | 113°C |
| Solubility | Soluble in ether and ether. Insoluble in water. |
| Vapor Presure | 1.52E-06mmHg at 25°C |
| Appearance | Powder |
| Color | White to Off-White |
| Merck | 14,1023 |
| BRN | 1795147 |
| Storage Condition | room temp |
| Refractive Index | 1.4339 (589.3 nm 60℃ |
| MDL | MFCD00009347 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| HS Code | 29159000 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| biological activity | Methyl behenate is a kind of natural fatty acid Methyl ester, it was isolated from the plant of Aspidopterys obcordata Lemsl. |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |